jamilecuzco jamilecuzco

22-03-2021
Mathematics

contestada

the experimental probability of spinning a number less than 3 is...?

the experimental probability of spinning a number less than 3 is class=

Respuesta :

naenae461510 naenae461510

22-03-2021

Answer:

14

Step-by-step explanation:

1=8

2=6

8+6=14

Answer Link

karen019 karen019

22-03-2021

There are 6 total possible results, so the probability of rolling a number less than 3 is 26 or 13 or 0.3333

Answer Link

Otras preguntas

Can an insulating material be used to charge a conductor? if so, how? if not, why not?.

Please Help Du Today...1. What is the simplified form of - ( x - 4 ) ?A. - x - 4B. - x + 4C. x +4D. x - 42. Which phrase can you use to represent, m - 4? A. m l

Find three consecutive odd integers such that 5 times the smallest is 9 less than 4 times the largest.

What species is represented by the following information? p = 17, e- = 18, n = 18

Part A: If Maria runs meters each week, how many miles does she run? Round your answer to the nearest tenth. (meter = yards) Part B: Maria wants to run 6 miles

How does sleep deprivation affect your ability to drive , a recent study measured the effects on 19 proffesional drivers?

Given the following endpoints, find the points that divide AB into four equal parts. A(-4,2) B(0,8)

What is the angle between two of the carbon-hydrogen bonds in the methane ( ) molecule?

Which skeletal structure corresponds to the condensed structure ch2(oh)ch2chchco2ch(ch3)2?

In windows 8/8.1 what is displayed when a user drops the cursor to the bottom left corner when in the start screen?