rubyelson2254 rubyelson2254

21-05-2020
Chemistry

contestada

How is a light bulb related to radiation?

Respuesta :

hanibun123456 hanibun123456

21-05-2020

light bulbs works by converting electricity into light by using electric currents. it emits electromagnetic radiation

Answer Link

rsmkite rsmkite

21-05-2020

Answer:

light bulb use electricity into light which a radiation

Explanation:

i already knew it

Answer Link

Otras preguntas

When the 1,7-diester CH3O2CCH2CH2CH(CH3)CH2CH2CO2CH3 is treated with sodium methoxide and the reaction mixture is subsequently neutralized with acid, what kind

Explain why the Berlin Airlift was a perfect example of brinkmanship

Which two of the senses are considered chemical senses

find the missing measures

A +15 nC point charge is placed on the x axis at x = 1.5 m, and a -20 nC charge is placed on the y axis at y = -2.0m. What is the magnitude of the electric fiel

If the mean GPA among students is 3.25 with a standard deviation of 1.75, and we select a random sample of 300 people, at what value for the sample mean would b

PLEASE PLEASE HELP MEETo be efficient, markets mustA. exist only on the Internet.B. have a single buyer and seller.C. have many competing buyers and sellers D.

How do metal atoms bond with one another?

After having been on the air for more than a decade, Fox's American Idol seemed to be suffering from viewer fatigue. The average number of viewers from the 2011

write the name of the sport or activity indicated by the art. Spanish form of volleyball